| Name | 4-chlorophthalic anhydride |
| Synonyms | 4-Chlorophthalic Chlorophtalicanhydre CHLOROPHTHALIC ANHYDRIDE 4-CHLOROPHTHALIC ANHYDRIDE ChlorophthalicAnhydride,4- 4-chlorophthalic anhydride 5-Chloroisobenzofuran-1,3-dione 5-chloro-2-benzofuran-1,3-dione 4-CHLOROPHTHALIC ACID ANHYDRIDE |
| CAS | 118-45-6 |
| EINECS | 204-251-9 |
| InChI | InChI=1/C8H3ClO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| Molecular Formula | C8H3ClO3 |
| Molar Mass | 182.56 |
| Density | 1.594±0.06 g/cm3(Predicted) |
| Melting Point | 96°C |
| Boling Point | 290 °C |
| Flash Point | 142.4°C |
| Solubility | soluble in Toluene |
| Vapor Presure | 0.058-0.058Pa at 25℃ |
| Appearance | White crystal |
| Color | White to Almost white |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.626 |
| MDL | MFCD00152354 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| LogP | 2.713 |
| use | mainly used in the synthesis of biphenyl dianhydride, monoether dianhydride, thioether dianhydride, diether dianhydride, etc. |